C11H16N2OS — CID 143623539
ethene;1-(2-pyrrolidin-2-yl-1,3-thiazol-4-yl)ethanone (PubChem CID 143623539) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is ethene;1-(2-pyrrolidin-2-yl-1,3-thiazol-4-yl)ethanone.
| Compound Name | ethene;1-(2-pyrrolidin-2-yl-1,3-thiazol-4-yl)ethanone |
|---|---|
| PubChem CID | 143623539 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | ethene;1-(2-pyrrolidin-2-yl-1,3-thiazol-4-yl)ethanone |
| SMILES | C=C.CC(=O)c1csc(C2CCCN2)n1 |
| InChI | InChI=1S/C9H12N2OS.C2H4/c1-6(12)8-5-13-9(11-8)7-3-2-4-10-7;1-2/h5,7,10H,2-4H2,1H3;1-2H2 |
| InChIKey | GSPFMRITERWEBA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|