C9H13N3OS — CID 21365763
2-(1-methylpyrrolidin-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 21365763) has the molecular formula C9H13N3OS and a molecular weight of 211.29 g/mol. Its IUPAC name is 2-(1-methylpyrrolidin-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(1-methylpyrrolidin-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 21365763 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-(1-methylpyrrolidin-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | CN1CCCC1c1nc(C(N)=O)cs1 |
| InChI | InChI=1S/C9H13N3OS/c1-12-4-2-3-7(12)9-11-6(5-14-9)8(10)13/h5,7H,2-4H2,1H3,(H2,10,13) |
| InChIKey | VRVMJMGMMOOWFR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |