C10H14N2O3S — CID 107017767
1-[2-(2-hydroxyethoxy)ethyl]-2-oxopyridine-3-carbothioamide (PubChem CID 107017767) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethoxy)ethyl]-2-oxopyridine-3-carbothioamide.
| Compound Name | 1-[2-(2-hydroxyethoxy)ethyl]-2-oxopyridine-3-carbothioamide |
|---|---|
| PubChem CID | 107017767 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 1-[2-(2-hydroxyethoxy)ethyl]-2-oxopyridine-3-carbothioamide |
| SMILES | NC(=S)c1cccn(CCOCCO)c1=O |
| InChI | InChI=1S/C10H14N2O3S/c11-9(16)8-2-1-3-12(10(8)14)4-6-15-7-5-13/h1-3,13H,4-7H2,(H2,11,16) |
| InChIKey | RPYKDVWOHXXCNB-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|