C14H13N5O2 — CID 107017979
N'-hydroxy-1-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-oxopyridine-3-carboximidamide (PubChem CID 107017979) has the molecular formula C14H13N5O2 and a molecular weight of 283.29 g/mol. Its IUPAC name is N'-hydroxy-1-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-oxopyridine-3-carboximidamide.
| Compound Name | N'-hydroxy-1-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-oxopyridine-3-carboximidamide |
|---|---|
| PubChem CID | 107017979 |
| Molecular Formula | C14H13N5O2 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | N'-hydroxy-1-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-oxopyridine-3-carboximidamide |
| SMILES | N/C(=N/O)c1cccn(Cc2cn3ccccc3n2)c1=O |
| InChI | InChI=1S/C14H13N5O2/c15-13(17-21)11-4-3-7-19(14(11)20)9-10-8-18-6-2-1-5-12(18)16-10/h1-8,21H,9H2,(H2,15,17) |
| InChIKey | GVWQWIAUFWLMMB-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 97.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|