C8H10FN3O2 — CID 107018024
1-(2-fluoroethyl)-N'-hydroxy-2-oxopyridine-3-carboximidamide (PubChem CID 107018024) has the molecular formula C8H10FN3O2 and a molecular weight of 199.19 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-N'-hydroxy-2-oxopyridine-3-carboximidamide.
| Compound Name | 1-(2-fluoroethyl)-N'-hydroxy-2-oxopyridine-3-carboximidamide |
|---|---|
| PubChem CID | 107018024 |
| Molecular Formula | C8H10FN3O2 |
| Molecular Weight | 199.19 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 1-(2-fluoroethyl)-N'-hydroxy-2-oxopyridine-3-carboximidamide |
| SMILES | N/C(=N/O)c1cccn(CCF)c1=O |
| InChI | InChI=1S/C8H10FN3O2/c9-3-5-12-4-1-2-6(8(12)13)7(10)11-14/h1-2,4,14H,3,5H2,(H2,10,11) |
| InChIKey | GAOYXVYVNSQQJI-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 80.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.19 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|