C11H14F3N3O3 — CID 107017970
N'-hydroxy-2-oxo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyridine-3-carboximidamide (PubChem CID 107017970) has the molecular formula C11H14F3N3O3 and a molecular weight of 293.25 g/mol. Its IUPAC name is N'-hydroxy-2-oxo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyridine-3-carboximidamide.
| Compound Name | N'-hydroxy-2-oxo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 107017970 |
| Molecular Formula | C11H14F3N3O3 |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N'-hydroxy-2-oxo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyridine-3-carboximidamide |
| SMILES | N/C(=N/O)c1cccn(CCCOCC(F)(F)F)c1=O |
| InChI | InChI=1S/C11H14F3N3O3/c12-11(13,14)7-20-6-2-5-17-4-1-3-8(10(17)18)9(15)16-19/h1,3-4,19H,2,5-7H2,(H2,15,16) |
| InChIKey | CHSUSBDTWFNFMH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|