C9H12FN3O2 — CID 107018041
1-(3-fluoropropyl)-N'-hydroxy-2-oxopyridine-3-carboximidamide (PubChem CID 107018041) has the molecular formula C9H12FN3O2 and a molecular weight of 213.21 g/mol. Its IUPAC name is 1-(3-fluoropropyl)-N'-hydroxy-2-oxopyridine-3-carboximidamide.
| Compound Name | 1-(3-fluoropropyl)-N'-hydroxy-2-oxopyridine-3-carboximidamide |
|---|---|
| PubChem CID | 107018041 |
| Molecular Formula | C9H12FN3O2 |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 1-(3-fluoropropyl)-N'-hydroxy-2-oxopyridine-3-carboximidamide |
| SMILES | N/C(=N/O)c1cccn(CCCF)c1=O |
| InChI | InChI=1S/C9H12FN3O2/c10-4-2-6-13-5-1-3-7(9(13)14)8(11)12-15/h1,3,5,15H,2,4,6H2,(H2,11,12) |
| InChIKey | FKRISTYZPHTFHA-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 80.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|