About 4-methylpentyl 2-[1-(sulfanylmethyl)cyclopropyl]acetate
4-methylpentyl 2-[1-(sulfanylmethyl)cyclopropyl]acetate (PubChem CID 107018573) has the molecular formula C12H22O2S
and a molecular weight of 230.37 g/mol. Its IUPAC name is 4-methylpentyl 2-[1-(sulfanylmethyl)cyclopropyl]acetate.
Molecular Properties
| Compound Name | 4-methylpentyl 2-[1-(sulfanylmethyl)cyclopropyl]acetate |
| PubChem CID | 107018573 |
| Molecular Formula | C12H22O2S |
| Molecular Weight | 230.37 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 4-methylpentyl 2-[1-(sulfanylmethyl)cyclopropyl]acetate |
| SMILES | CC(C)CCCOC(=O)CC1(CS)CC1 |
| InChI | InChI=1S/C12H22O2S/c1-10(2)4-3-7-14-11(13)8-12(9-15)5-6-12/h10,15H,3-9H2,1-2H3 |
| InChIKey | KEXAMVGWWGKCPZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpentyl 2-[1-(sulfanylmethyl)cyclopropyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentyl 2-[1-(sulfanylmethyl)cyclopropyl]acetate?
The IUPAC name of 4-methylpentyl 2-[1-(sulfanylmethyl)cyclopropyl]acetate (CID 107018573) is 4-methylpentyl 2-[1-(sulfanylmethyl)cyclopropyl]acetate.
What is the SMILES notation for 4-methylpentyl 2-[1-(sulfanylmethyl)cyclopropyl]acetate?
The canonical SMILES for 4-methylpentyl 2-[1-(sulfanylmethyl)cyclopropyl]acetate is CC(C)CCCOC(=O)CC1(CS)CC1.
What is the InChIKey of 4-methylpentyl 2-[1-(sulfanylmethyl)cyclopropyl]acetate?
The InChIKey is KEXAMVGWWGKCPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2S/c1-10(2)4-3-7-14-11(13)8-12(9-15)5-6-12/h10,15H,3-9H2,1-2H3.
What are the key properties of 4-methylpentyl 2-[1-(sulfanylmethyl)cyclopropyl]acetate?
4-methylpentyl 2-[1-(sulfanylmethyl)cyclopropyl]acetate has a molecular weight of 230.37 g/mol, XLogP of 3.07, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentyl 2-[1-(sulfanylmethyl)cyclopropyl]acetate is sourced from PubChem (CID 107018573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).