About 9-methyldecyl 2-(1-bicyclo[1.1.1]pentanyl)acetate
9-methyldecyl 2-(1-bicyclo[1.1.1]pentanyl)acetate (PubChem CID 170937784) has the molecular formula C18H32O2
and a molecular weight of 280.45 g/mol. Its IUPAC name is 9-methyldecyl 2-(1-bicyclo[1.1.1]pentanyl)acetate.
Molecular Properties
| Compound Name | 9-methyldecyl 2-(1-bicyclo[1.1.1]pentanyl)acetate |
| PubChem CID | 170937784 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 9-methyldecyl 2-(1-bicyclo[1.1.1]pentanyl)acetate |
| SMILES | CC(C)CCCCCCCCOC(=O)CC12CC(C1)C2 |
| InChI | InChI=1S/C18H32O2/c1-15(2)9-7-5-3-4-6-8-10-20-17(19)14-18-11-16(12-18)13-18/h15-16H,3-14H2,1-2H3 |
| InChIKey | CDYFRIAMRGAQJZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-methyldecyl 2-(1-bicyclo[1.1.1]pentanyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyldecyl 2-(1-bicyclo[1.1.1]pentanyl)acetate?
The IUPAC name of 9-methyldecyl 2-(1-bicyclo[1.1.1]pentanyl)acetate (CID 170937784) is 9-methyldecyl 2-(1-bicyclo[1.1.1]pentanyl)acetate.
What is the SMILES notation for 9-methyldecyl 2-(1-bicyclo[1.1.1]pentanyl)acetate?
The canonical SMILES for 9-methyldecyl 2-(1-bicyclo[1.1.1]pentanyl)acetate is CC(C)CCCCCCCCOC(=O)CC12CC(C1)C2.
What is the InChIKey of 9-methyldecyl 2-(1-bicyclo[1.1.1]pentanyl)acetate?
The InChIKey is CDYFRIAMRGAQJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O2/c1-15(2)9-7-5-3-4-6-8-10-20-17(19)14-18-11-16(12-18)13-18/h15-16H,3-14H2,1-2H3.
What are the key properties of 9-methyldecyl 2-(1-bicyclo[1.1.1]pentanyl)acetate?
9-methyldecyl 2-(1-bicyclo[1.1.1]pentanyl)acetate has a molecular weight of 280.45 g/mol, XLogP of 5.11, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyldecyl 2-(1-bicyclo[1.1.1]pentanyl)acetate is sourced from PubChem (CID 170937784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).