C14H24O2S — CID 107018899
(3,5-dimethylcyclohexyl) 2-[1-(sulfanylmethyl)cyclopropyl]acetate (PubChem CID 107018899) has the molecular formula C14H24O2S and a molecular weight of 256.41 g/mol. Its IUPAC name is (3,5-dimethylcyclohexyl) 2-[1-(sulfanylmethyl)cyclopropyl]acetate.
| Compound Name | (3,5-dimethylcyclohexyl) 2-[1-(sulfanylmethyl)cyclopropyl]acetate |
|---|---|
| PubChem CID | 107018899 |
| Molecular Formula | C14H24O2S |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | (3,5-dimethylcyclohexyl) 2-[1-(sulfanylmethyl)cyclopropyl]acetate |
| SMILES | CC1CC(C)CC(OC(=O)CC2(CS)CC2)C1 |
| InChI | InChI=1S/C14H24O2S/c1-10-5-11(2)7-12(6-10)16-13(15)8-14(9-17)3-4-14/h10-12,17H,3-9H2,1-2H3 |
| InChIKey | UDCNIKAVXLHVJP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|