C15H14FNOS2 — CID 107028709
4-fluoro-3-sulfanyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzamide (PubChem CID 107028709) has the molecular formula C15H14FNOS2 and a molecular weight of 307.42 g/mol. Its IUPAC name is 4-fluoro-3-sulfanyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzamide.
| Compound Name | 4-fluoro-3-sulfanyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzamide |
|---|---|
| PubChem CID | 107028709 |
| Molecular Formula | C15H14FNOS2 |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 4-fluoro-3-sulfanyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzamide |
| SMILES | O=C(NC1CCCc2sccc21)c1ccc(F)c(S)c1 |
| InChI | InChI=1S/C15H14FNOS2/c16-11-5-4-9(8-13(11)19)15(18)17-12-2-1-3-14-10(12)6-7-20-14/h4-8,12,19H,1-3H2,(H,17,18) |
| InChIKey | QMVMXXYECQNROP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|