C15H16FN3OS — CID 62843049
3-fluoro-2-hydrazinyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzamide (PubChem CID 62843049) has the molecular formula C15H16FN3OS and a molecular weight of 305.38 g/mol. Its IUPAC name is 3-fluoro-2-hydrazinyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzamide.
| Compound Name | 3-fluoro-2-hydrazinyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzamide |
|---|---|
| PubChem CID | 62843049 |
| Molecular Formula | C15H16FN3OS |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 3-fluoro-2-hydrazinyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzamide |
| SMILES | NNc1c(F)cccc1C(=O)NC1CCCc2sccc21 |
| InChI | InChI=1S/C15H16FN3OS/c16-11-4-1-3-10(14(11)19-17)15(20)18-12-5-2-6-13-9(12)7-8-21-13/h1,3-4,7-8,12,19H,2,5-6,17H2,(H,18,20) |
| InChIKey | OJLWWEQHQHNPPF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|