C15H15ClN2OS — CID 115930522
3-amino-2-chloro-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzamide (PubChem CID 115930522) has the molecular formula C15H15ClN2OS and a molecular weight of 306.82 g/mol. Its IUPAC name is 3-amino-2-chloro-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzamide.
| Compound Name | 3-amino-2-chloro-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzamide |
|---|---|
| PubChem CID | 115930522 |
| Molecular Formula | C15H15ClN2OS |
| Molecular Weight | 306.82 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 3-amino-2-chloro-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzamide |
| SMILES | Nc1cccc(C(=O)NC2CCCc3sccc32)c1Cl |
| InChI | InChI=1S/C15H15ClN2OS/c16-14-10(3-1-4-11(14)17)15(19)18-12-5-2-6-13-9(12)7-8-20-13/h1,3-4,7-8,12H,2,5-6,17H2,(H,18,19) |
| InChIKey | XBCZIFAFGYWYNZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.82 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|