C15H15BrN2OS — CID 62841982
3-amino-4-bromo-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzamide (PubChem CID 62841982) has the molecular formula C15H15BrN2OS and a molecular weight of 351.27 g/mol. Its IUPAC name is 3-amino-4-bromo-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzamide.
| Compound Name | 3-amino-4-bromo-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzamide |
|---|---|
| PubChem CID | 62841982 |
| Molecular Formula | C15H15BrN2OS |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 3-amino-4-bromo-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzamide |
| SMILES | Nc1cc(C(=O)NC2CCCc3sccc32)ccc1Br |
| InChI | InChI=1S/C15H15BrN2OS/c16-11-5-4-9(8-12(11)17)15(19)18-13-2-1-3-14-10(13)6-7-20-14/h4-8,13H,1-3,17H2,(H,18,19) |
| InChIKey | GQWBAYUIYUDZAV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|