C12H20N2 — CID 10702926
2,2,7,7-tetramethyl-1,3,5,6-tetrahydro-1,8-naphthyridine (PubChem CID 10702926) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 2,2,7,7-tetramethyl-1,3,5,6-tetrahydro-1,8-naphthyridine.
| Compound Name | 2,2,7,7-tetramethyl-1,3,5,6-tetrahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 10702926 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2,2,7,7-tetramethyl-1,3,5,6-tetrahydro-1,8-naphthyridine |
| SMILES | CC1(C)CCC2=CCC(C)(C)NC2=N1 |
| InChI | InChI=1S/C12H20N2/c1-11(2)7-5-9-6-8-12(3,4)14-10(9)13-11/h5H,6-8H2,1-4H3,(H,13,14) |
| InChIKey | QUOCKIXPIAIZQT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |