About (2Z)-2-ethylidene-N'-methyl-N-(2-methylbutan-2-yl)hex-5-enimidamide
(2Z)-2-ethylidene-N'-methyl-N-(2-methylbutan-2-yl)hex-5-enimidamide (PubChem CID 145193328) has the molecular formula C14H26N2
and a molecular weight of 222.38 g/mol. Its IUPAC name is (2Z)-2-ethylidene-N'-methyl-N-(2-methylbutan-2-yl)hex-5-enimidamide.
Molecular Properties
| Compound Name | (2Z)-2-ethylidene-N'-methyl-N-(2-methylbutan-2-yl)hex-5-enimidamide |
| PubChem CID | 145193328 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | (2Z)-2-ethylidene-N'-methyl-N-(2-methylbutan-2-yl)hex-5-enimidamide |
| SMILES | C=CCCC(=C/C)/C(=N/C)NC(C)(C)CC |
| InChI | InChI=1S/C14H26N2/c1-7-10-11-12(8-2)13(15-6)16-14(4,5)9-3/h7-8H,1,9-11H2,2-6H3,(H,15,16)/b12-8- |
| InChIKey | XFOCAONTWJEKNX-WQLSENKSSA-N |
| XLogP | 3.71 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-ethylidene-N'-methyl-N-(2-methylbutan-2-yl)hex-5-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-ethylidene-N'-methyl-N-(2-methylbutan-2-yl)hex-5-enimidamide?
The IUPAC name of (2Z)-2-ethylidene-N'-methyl-N-(2-methylbutan-2-yl)hex-5-enimidamide (CID 145193328) is (2Z)-2-ethylidene-N'-methyl-N-(2-methylbutan-2-yl)hex-5-enimidamide.
What is the SMILES notation for (2Z)-2-ethylidene-N'-methyl-N-(2-methylbutan-2-yl)hex-5-enimidamide?
The canonical SMILES for (2Z)-2-ethylidene-N'-methyl-N-(2-methylbutan-2-yl)hex-5-enimidamide is C=CCCC(=C/C)/C(=N/C)NC(C)(C)CC.
What is the InChIKey of (2Z)-2-ethylidene-N'-methyl-N-(2-methylbutan-2-yl)hex-5-enimidamide?
The InChIKey is XFOCAONTWJEKNX-WQLSENKSSA-N. The full InChI is InChI=1S/C14H26N2/c1-7-10-11-12(8-2)13(15-6)16-14(4,5)9-3/h7-8H,1,9-11H2,2-6H3,(H,15,16)/b12-8-.
What are the key properties of (2Z)-2-ethylidene-N'-methyl-N-(2-methylbutan-2-yl)hex-5-enimidamide?
(2Z)-2-ethylidene-N'-methyl-N-(2-methylbutan-2-yl)hex-5-enimidamide has a molecular weight of 222.38 g/mol, XLogP of 3.71, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-ethylidene-N'-methyl-N-(2-methylbutan-2-yl)hex-5-enimidamide is sourced from PubChem (CID 145193328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).