C14H22N2 — CID 156714183
N,7,7-trimethyl-3-(3-methylbut-1-en-2-yl)-1H-azepin-2-imine (PubChem CID 156714183) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is N,7,7-trimethyl-3-(3-methylbut-1-en-2-yl)-1H-azepin-2-imine.
| Compound Name | N,7,7-trimethyl-3-(3-methylbut-1-en-2-yl)-1H-azepin-2-imine |
|---|---|
| PubChem CID | 156714183 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | N,7,7-trimethyl-3-(3-methylbut-1-en-2-yl)-1H-azepin-2-imine |
| SMILES | C=C(C1=CC=CC(C)(C)N/C1=N\C)C(C)C |
| InChI | InChI=1S/C14H22N2/c1-10(2)11(3)12-8-7-9-14(4,5)16-13(12)15-6/h7-10H,3H2,1-2,4-6H3,(H,15,16) |
| InChIKey | VFDGYNSTGQYOLR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|