C10H19NOS2 — CID 107030296
N-(3-methylsulfanylpropyl)-2-[1-(sulfanylmethyl)cyclopropyl]acetamide (PubChem CID 107030296) has the molecular formula C10H19NOS2 and a molecular weight of 233.40 g/mol. Its IUPAC name is N-(3-methylsulfanylpropyl)-2-[1-(sulfanylmethyl)cyclopropyl]acetamide.
| Compound Name | N-(3-methylsulfanylpropyl)-2-[1-(sulfanylmethyl)cyclopropyl]acetamide |
|---|---|
| PubChem CID | 107030296 |
| Molecular Formula | C10H19NOS2 |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | N-(3-methylsulfanylpropyl)-2-[1-(sulfanylmethyl)cyclopropyl]acetamide |
| SMILES | CSCCCNC(=O)CC1(CS)CC1 |
| InChI | InChI=1S/C10H19NOS2/c1-14-6-2-5-11-9(12)7-10(8-13)3-4-10/h13H,2-8H2,1H3,(H,11,12) |
| InChIKey | CJFDZEBQTVDSBK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|