C10H16F3NO2S — CID 107030144
2-[1-(sulfanylmethyl)cyclopropyl]-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide (PubChem CID 107030144) has the molecular formula C10H16F3NO2S and a molecular weight of 271.30 g/mol. Its IUPAC name is 2-[1-(sulfanylmethyl)cyclopropyl]-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide.
| Compound Name | 2-[1-(sulfanylmethyl)cyclopropyl]-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 107030144 |
| Molecular Formula | C10H16F3NO2S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 2-[1-(sulfanylmethyl)cyclopropyl]-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide |
| SMILES | O=C(CC1(CS)CC1)NCCOCC(F)(F)F |
| InChI | InChI=1S/C10H16F3NO2S/c11-10(12,13)6-16-4-3-14-8(15)5-9(7-17)1-2-9/h17H,1-7H2,(H,14,15) |
| InChIKey | DIQXZANAZSXHOW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|