C12H23NOS — CID 107035900
N-(3,3-dimethylbutyl)-2-[1-(sulfanylmethyl)cyclopropyl]acetamide (PubChem CID 107035900) has the molecular formula C12H23NOS and a molecular weight of 229.39 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-2-[1-(sulfanylmethyl)cyclopropyl]acetamide.
| Compound Name | N-(3,3-dimethylbutyl)-2-[1-(sulfanylmethyl)cyclopropyl]acetamide |
|---|---|
| PubChem CID | 107035900 |
| Molecular Formula | C12H23NOS |
| Molecular Weight | 229.39 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | N-(3,3-dimethylbutyl)-2-[1-(sulfanylmethyl)cyclopropyl]acetamide |
| SMILES | CC(C)(C)CCNC(=O)CC1(CS)CC1 |
| InChI | InChI=1S/C12H23NOS/c1-11(2,3)6-7-13-10(14)8-12(9-15)4-5-12/h15H,4-9H2,1-3H3,(H,13,14) |
| InChIKey | BQPFTNACJTXJTP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|