About N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-[1-(sulfanylmethyl)cyclopropyl]acetamide
N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-[1-(sulfanylmethyl)cyclopropyl]acetamide (PubChem CID 107854816) has the molecular formula C10H19NO4S
and a molecular weight of 249.33 g/mol. Its IUPAC name is N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-[1-(sulfanylmethyl)cyclopropyl]acetamide.
Molecular Properties
| Compound Name | N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-[1-(sulfanylmethyl)cyclopropyl]acetamide |
| PubChem CID | 107854816 |
| Molecular Formula | C10H19NO4S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-[1-(sulfanylmethyl)cyclopropyl]acetamide |
| SMILES | O=C(CC1(CS)CC1)NC(CO)(CO)CO |
| InChI | InChI=1S/C10H19NO4S/c12-4-10(5-13,6-14)11-8(15)3-9(7-16)1-2-9/h12-14,16H,1-7H2,(H,11,15) |
| InChIKey | UHCKAPUFROWXPQ-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-[1-(sulfanylmethyl)cyclopropyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-[1-(sulfanylmethyl)cyclopropyl]acetamide?
The IUPAC name of N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-[1-(sulfanylmethyl)cyclopropyl]acetamide (CID 107854816) is N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-[1-(sulfanylmethyl)cyclopropyl]acetamide.
What is the SMILES notation for N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-[1-(sulfanylmethyl)cyclopropyl]acetamide?
The canonical SMILES for N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-[1-(sulfanylmethyl)cyclopropyl]acetamide is O=C(CC1(CS)CC1)NC(CO)(CO)CO.
What is the InChIKey of N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-[1-(sulfanylmethyl)cyclopropyl]acetamide?
The InChIKey is UHCKAPUFROWXPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO4S/c12-4-10(5-13,6-14)11-8(15)3-9(7-16)1-2-9/h12-14,16H,1-7H2,(H,11,15).
What are the key properties of N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-[1-(sulfanylmethyl)cyclopropyl]acetamide?
N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-[1-(sulfanylmethyl)cyclopropyl]acetamide has a molecular weight of 249.33 g/mol, XLogP of -1.08, 7 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-[1-(sulfanylmethyl)cyclopropyl]acetamide is sourced from PubChem (CID 107854816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).