C15H18ClNOS — CID 107030501
2-chloro-N,N-bis(cyclopropylmethyl)-5-sulfanylbenzamide (PubChem CID 107030501) has the molecular formula C15H18ClNOS and a molecular weight of 295.83 g/mol. Its IUPAC name is 2-chloro-N,N-bis(cyclopropylmethyl)-5-sulfanylbenzamide.
| Compound Name | 2-chloro-N,N-bis(cyclopropylmethyl)-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107030501 |
| Molecular Formula | C15H18ClNOS |
| Molecular Weight | 295.83 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2-chloro-N,N-bis(cyclopropylmethyl)-5-sulfanylbenzamide |
| SMILES | O=C(c1cc(S)ccc1Cl)N(CC1CC1)CC1CC1 |
| InChI | InChI=1S/C15H18ClNOS/c16-14-6-5-12(19)7-13(14)15(18)17(8-10-1-2-10)9-11-3-4-11/h5-7,10-11,19H,1-4,8-9H2 |
| InChIKey | TVSIGLVCYWIAPZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.83 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|