C16H21NOS — CID 107030502
N,N-bis(cyclopropylmethyl)-2-(4-sulfanylphenyl)acetamide (PubChem CID 107030502) has the molecular formula C16H21NOS and a molecular weight of 275.42 g/mol. Its IUPAC name is N,N-bis(cyclopropylmethyl)-2-(4-sulfanylphenyl)acetamide.
| Compound Name | N,N-bis(cyclopropylmethyl)-2-(4-sulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 107030502 |
| Molecular Formula | C16H21NOS |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N,N-bis(cyclopropylmethyl)-2-(4-sulfanylphenyl)acetamide |
| SMILES | O=C(Cc1ccc(S)cc1)N(CC1CC1)CC1CC1 |
| InChI | InChI=1S/C16H21NOS/c18-16(9-12-5-7-15(19)8-6-12)17(10-13-1-2-13)11-14-3-4-14/h5-8,13-14,19H,1-4,9-11H2 |
| InChIKey | IVGKHDQTUXHQJC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|