C10H18O2Si — CID 10703131
(3S,4R)-4-ethenyl-3-[(1R)-1-trimethylsilylethyl]oxetan-2-one (PubChem CID 10703131) has the molecular formula C10H18O2Si and a molecular weight of 198.34 g/mol. Its IUPAC name is (3S,4R)-4-ethenyl-3-[(1R)-1-trimethylsilylethyl]oxetan-2-one.
| Compound Name | (3S,4R)-4-ethenyl-3-[(1R)-1-trimethylsilylethyl]oxetan-2-one |
|---|---|
| PubChem CID | 10703131 |
| Molecular Formula | C10H18O2Si |
| Molecular Weight | 198.34 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | (3S,4R)-4-ethenyl-3-[(1R)-1-trimethylsilylethyl]oxetan-2-one |
| SMILES | C=C[C@H]1OC(=O)[C@H]1[C@@H](C)[Si](C)(C)C |
| InChI | InChI=1S/C10H18O2Si/c1-6-8-9(10(11)12-8)7(2)13(3,4)5/h6-9H,1H2,2-5H3/t7-,8-,9+/m1/s1 |
| InChIKey | IDSOARPKPZNJQP-HLTSFMKQSA-N |
| XLogP | 2.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|