C10H15NOS3 — CID 107035311
N-(4-methylsulfanylbutan-2-yl)-4-sulfanylthiophene-2-carboxamide (PubChem CID 107035311) has the molecular formula C10H15NOS3 and a molecular weight of 261.44 g/mol. Its IUPAC name is N-(4-methylsulfanylbutan-2-yl)-4-sulfanylthiophene-2-carboxamide.
| Compound Name | N-(4-methylsulfanylbutan-2-yl)-4-sulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 107035311 |
| Molecular Formula | C10H15NOS3 |
| Molecular Weight | 261.44 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | N-(4-methylsulfanylbutan-2-yl)-4-sulfanylthiophene-2-carboxamide |
| SMILES | CSCCC(C)NC(=O)c1cc(S)cs1 |
| InChI | InChI=1S/C10H15NOS3/c1-7(3-4-14-2)11-10(12)9-5-8(13)6-15-9/h5-7,13H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | CUWYKIXRCVPFNK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|