C11H17NOS2 — CID 107025092
N-(2-methylpentan-3-yl)-4-sulfanylthiophene-2-carboxamide (PubChem CID 107025092) has the molecular formula C11H17NOS2 and a molecular weight of 243.40 g/mol. Its IUPAC name is N-(2-methylpentan-3-yl)-4-sulfanylthiophene-2-carboxamide.
| Compound Name | N-(2-methylpentan-3-yl)-4-sulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 107025092 |
| Molecular Formula | C11H17NOS2 |
| Molecular Weight | 243.40 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | N-(2-methylpentan-3-yl)-4-sulfanylthiophene-2-carboxamide |
| SMILES | CCC(NC(=O)c1cc(S)cs1)C(C)C |
| InChI | InChI=1S/C11H17NOS2/c1-4-9(7(2)3)12-11(13)10-5-8(14)6-15-10/h5-7,9,14H,4H2,1-3H3,(H,12,13) |
| InChIKey | VVUQLHGNPHJBST-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|