About butan-2-yl 4-sulfanylthiophene-2-carboxylate
butan-2-yl 4-sulfanylthiophene-2-carboxylate (PubChem CID 107018189) has the molecular formula C9H12O2S2
and a molecular weight of 216.33 g/mol. Its IUPAC name is butan-2-yl 4-sulfanylthiophene-2-carboxylate.
Molecular Properties
| Compound Name | butan-2-yl 4-sulfanylthiophene-2-carboxylate |
| PubChem CID | 107018189 |
| Molecular Formula | C9H12O2S2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | butan-2-yl 4-sulfanylthiophene-2-carboxylate |
| SMILES | CCC(C)OC(=O)c1cc(S)cs1 |
| InChI | InChI=1S/C9H12O2S2/c1-3-6(2)11-9(10)8-4-7(12)5-13-8/h4-6,12H,3H2,1-2H3 |
| InChIKey | XNUBWZYLJHMIEL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze butan-2-yl 4-sulfanylthiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl 4-sulfanylthiophene-2-carboxylate?
The IUPAC name of butan-2-yl 4-sulfanylthiophene-2-carboxylate (CID 107018189) is butan-2-yl 4-sulfanylthiophene-2-carboxylate.
What is the SMILES notation for butan-2-yl 4-sulfanylthiophene-2-carboxylate?
The canonical SMILES for butan-2-yl 4-sulfanylthiophene-2-carboxylate is CCC(C)OC(=O)c1cc(S)cs1.
What is the InChIKey of butan-2-yl 4-sulfanylthiophene-2-carboxylate?
The InChIKey is XNUBWZYLJHMIEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2S2/c1-3-6(2)11-9(10)8-4-7(12)5-13-8/h4-6,12H,3H2,1-2H3.
What are the key properties of butan-2-yl 4-sulfanylthiophene-2-carboxylate?
butan-2-yl 4-sulfanylthiophene-2-carboxylate has a molecular weight of 216.33 g/mol, XLogP of 2.99, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl 4-sulfanylthiophene-2-carboxylate is sourced from PubChem (CID 107018189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).