C10H14N2OS2 — CID 107035938
2-[1-(sulfanylmethyl)cyclopropyl]-N-(1,3-thiazol-5-ylmethyl)acetamide (PubChem CID 107035938) has the molecular formula C10H14N2OS2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 2-[1-(sulfanylmethyl)cyclopropyl]-N-(1,3-thiazol-5-ylmethyl)acetamide.
| Compound Name | 2-[1-(sulfanylmethyl)cyclopropyl]-N-(1,3-thiazol-5-ylmethyl)acetamide |
|---|---|
| PubChem CID | 107035938 |
| Molecular Formula | C10H14N2OS2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 2-[1-(sulfanylmethyl)cyclopropyl]-N-(1,3-thiazol-5-ylmethyl)acetamide |
| SMILES | O=C(CC1(CS)CC1)NCc1cncs1 |
| InChI | InChI=1S/C10H14N2OS2/c13-9(3-10(6-14)1-2-10)12-5-8-4-11-7-15-8/h4,7,14H,1-3,5-6H2,(H,12,13) |
| InChIKey | SZOCMRYOZQRHFM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|