C13H11BrClNO2S — CID 107039551
methyl 3-[2-(2-bromo-5-chlorophenyl)-1,3-thiazol-4-yl]propanoate (PubChem CID 107039551) has the molecular formula C13H11BrClNO2S and a molecular weight of 360.66 g/mol. Its IUPAC name is methyl 3-[2-(2-bromo-5-chlorophenyl)-1,3-thiazol-4-yl]propanoate.
| Compound Name | methyl 3-[2-(2-bromo-5-chlorophenyl)-1,3-thiazol-4-yl]propanoate |
|---|---|
| PubChem CID | 107039551 |
| Molecular Formula | C13H11BrClNO2S |
| Molecular Weight | 360.66 g/mol |
| Exact Mass | 358.94 |
| IUPAC Name | methyl 3-[2-(2-bromo-5-chlorophenyl)-1,3-thiazol-4-yl]propanoate |
| SMILES | COC(=O)CCc1csc(-c2cc(Cl)ccc2Br)n1 |
| InChI | InChI=1S/C13H11BrClNO2S/c1-18-12(17)5-3-9-7-19-13(16-9)10-6-8(15)2-4-11(10)14/h2,4,6-7H,3,5H2,1H3 |
| InChIKey | RQGFWFRBKDXKRG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.66 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |