methyl 3-[2-(2-aminoethyl)-1,3-thiazol-4-yl]propanoate

C9H14N2O2S — CID 94256912

IUPACmethyl 3-[2-(2-aminoethyl)-1,3-thiazol-4-yl]propanoate
SMILESCOC(=O)CCc1csc(CCN)n1
InChIInChI=1S/C9H14N2O2S/c1-13-9(12)3-2-7-6-14-8(11-7)4-5-10/h6H,2-5,10H2,1H3
InChIKeyLWAFLUGANAMRQU-UHFFFAOYSA-N
MW214.29 g/mol
LogP0.75
Rot. Bonds5

About methyl 3-[2-(2-aminoethyl)-1,3-thiazol-4-yl]propanoate

methyl 3-[2-(2-aminoethyl)-1,3-thiazol-4-yl]propanoate (PubChem CID 94256912) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is methyl 3-[2-(2-aminoethyl)-1,3-thiazol-4-yl]propanoate.

Molecular Properties

Compound Namemethyl 3-[2-(2-aminoethyl)-1,3-thiazol-4-yl]propanoate
PubChem CID94256912
Molecular FormulaC9H14N2O2S
Molecular Weight214.29 g/mol
Exact Mass214.08
IUPAC Namemethyl 3-[2-(2-aminoethyl)-1,3-thiazol-4-yl]propanoate
SMILESCOC(=O)CCc1csc(CCN)n1
InChIInChI=1S/C9H14N2O2S/c1-13-9(12)3-2-7-6-14-8(11-7)4-5-10/h6H,2-5,10H2,1H3
InChIKeyLWAFLUGANAMRQU-UHFFFAOYSA-N
XLogP0.75
TPSA65.21 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.29
LogP ≤ 50.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 3-[2-(2-aminoethyl)-1,3-thiazol-4-yl]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[2-(2-aminoethyl)-1,3-thiazol-4-yl]propanoate?
The IUPAC name of methyl 3-[2-(2-aminoethyl)-1,3-thiazol-4-yl]propanoate (CID 94256912) is methyl 3-[2-(2-aminoethyl)-1,3-thiazol-4-yl]propanoate.
What is the SMILES notation for methyl 3-[2-(2-aminoethyl)-1,3-thiazol-4-yl]propanoate?
The canonical SMILES for methyl 3-[2-(2-aminoethyl)-1,3-thiazol-4-yl]propanoate is COC(=O)CCc1csc(CCN)n1.
What is the InChIKey of methyl 3-[2-(2-aminoethyl)-1,3-thiazol-4-yl]propanoate?
The InChIKey is LWAFLUGANAMRQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2S/c1-13-9(12)3-2-7-6-14-8(11-7)4-5-10/h6H,2-5,10H2,1H3.
What are the key properties of methyl 3-[2-(2-aminoethyl)-1,3-thiazol-4-yl]propanoate?
methyl 3-[2-(2-aminoethyl)-1,3-thiazol-4-yl]propanoate has a molecular weight of 214.29 g/mol, XLogP of 0.75, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2-(2-aminoethyl)-1,3-thiazol-4-yl]propanoate is sourced from PubChem (CID 94256912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).