C7H12N4O4S — CID 107043083
2-methyl-3-[(2-methyltetrazol-5-yl)methylsulfonyl]propanoic acid (PubChem CID 107043083) has the molecular formula C7H12N4O4S and a molecular weight of 248.26 g/mol. Its IUPAC name is 2-methyl-3-[(2-methyltetrazol-5-yl)methylsulfonyl]propanoic acid.
| Compound Name | 2-methyl-3-[(2-methyltetrazol-5-yl)methylsulfonyl]propanoic acid |
|---|---|
| PubChem CID | 107043083 |
| Molecular Formula | C7H12N4O4S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 2-methyl-3-[(2-methyltetrazol-5-yl)methylsulfonyl]propanoic acid |
| SMILES | CC(CS(=O)(=O)Cc1nnn(C)n1)C(=O)O |
| InChI | InChI=1S/C7H12N4O4S/c1-5(7(12)13)3-16(14,15)4-6-8-10-11(2)9-6/h5H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | YABIOEBOJUKPAY-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |