C6H9N5O3 — CID 107043216
2-formamido-3-(2-methyltetrazol-5-yl)propanoic acid (PubChem CID 107043216) has the molecular formula C6H9N5O3 and a molecular weight of 199.17 g/mol. Its IUPAC name is 2-formamido-3-(2-methyltetrazol-5-yl)propanoic acid.
| Compound Name | 2-formamido-3-(2-methyltetrazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 107043216 |
| Molecular Formula | C6H9N5O3 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 2-formamido-3-(2-methyltetrazol-5-yl)propanoic acid |
| SMILES | Cn1nnc(CC(NC=O)C(=O)O)n1 |
| InChI | InChI=1S/C6H9N5O3/c1-11-9-5(8-10-11)2-4(6(13)14)7-3-12/h3-4H,2H2,1H3,(H,7,12)(H,13,14) |
| InChIKey | BTBIQVJUDFSYGK-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|