C9H9BrClN3OS — CID 107046517
1-(4-bromo-5-chlorothiophen-2-yl)-2-(1-methyltriazol-4-yl)ethanol (PubChem CID 107046517) has the molecular formula C9H9BrClN3OS and a molecular weight of 322.62 g/mol. Its IUPAC name is 1-(4-bromo-5-chlorothiophen-2-yl)-2-(1-methyltriazol-4-yl)ethanol.
| Compound Name | 1-(4-bromo-5-chlorothiophen-2-yl)-2-(1-methyltriazol-4-yl)ethanol |
|---|---|
| PubChem CID | 107046517 |
| Molecular Formula | C9H9BrClN3OS |
| Molecular Weight | 322.62 g/mol |
| Exact Mass | 320.93 |
| IUPAC Name | 1-(4-bromo-5-chlorothiophen-2-yl)-2-(1-methyltriazol-4-yl)ethanol |
| SMILES | Cn1cc(CC(O)c2cc(Br)c(Cl)s2)nn1 |
| InChI | InChI=1S/C9H9BrClN3OS/c1-14-4-5(12-13-14)2-7(15)8-3-6(10)9(11)16-8/h3-4,7,15H,2H2,1H3 |
| InChIKey | NUMNPWKIPSNDJD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.62 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |