C6H7F3N4O — CID 107046920
4,4,4-trifluoro-1-(2-methyltetrazol-5-yl)butan-2-one (PubChem CID 107046920) has the molecular formula C6H7F3N4O and a molecular weight of 208.14 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-(2-methyltetrazol-5-yl)butan-2-one.
| Compound Name | 4,4,4-trifluoro-1-(2-methyltetrazol-5-yl)butan-2-one |
|---|---|
| PubChem CID | 107046920 |
| Molecular Formula | C6H7F3N4O |
| Molecular Weight | 208.14 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 4,4,4-trifluoro-1-(2-methyltetrazol-5-yl)butan-2-one |
| SMILES | Cn1nnc(CC(=O)CC(F)(F)F)n1 |
| InChI | InChI=1S/C6H7F3N4O/c1-13-11-5(10-12-13)2-4(14)3-6(7,8)9/h2-3H2,1H3 |
| InChIKey | VIQSABYFNTVSDM-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.14 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |