C5H4F4N4O — CID 130892337
2,2,3,3-tetrafluoro-1-(2-methyltetrazol-5-yl)propan-1-one (PubChem CID 130892337) has the molecular formula C5H4F4N4O and a molecular weight of 212.11 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-1-(2-methyltetrazol-5-yl)propan-1-one.
| Compound Name | 2,2,3,3-tetrafluoro-1-(2-methyltetrazol-5-yl)propan-1-one |
|---|---|
| PubChem CID | 130892337 |
| Molecular Formula | C5H4F4N4O |
| Molecular Weight | 212.11 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 2,2,3,3-tetrafluoro-1-(2-methyltetrazol-5-yl)propan-1-one |
| SMILES | Cn1nnc(C(=O)C(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C5H4F4N4O/c1-13-11-3(10-12-13)2(14)5(8,9)4(6)7/h4H,1H3 |
| InChIKey | VLLIWKFQWCFBOU-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.11 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|