C9H19N5O2 — CID 107050132
1,1-diethoxy-3-(2-methyltetrazol-5-yl)propan-2-amine (PubChem CID 107050132) has the molecular formula C9H19N5O2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 1,1-diethoxy-3-(2-methyltetrazol-5-yl)propan-2-amine.
| Compound Name | 1,1-diethoxy-3-(2-methyltetrazol-5-yl)propan-2-amine |
|---|---|
| PubChem CID | 107050132 |
| Molecular Formula | C9H19N5O2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 1,1-diethoxy-3-(2-methyltetrazol-5-yl)propan-2-amine |
| SMILES | CCOC(OCC)C(N)Cc1nnn(C)n1 |
| InChI | InChI=1S/C9H19N5O2/c1-4-15-9(16-5-2)7(10)6-8-11-13-14(3)12-8/h7,9H,4-6,10H2,1-3H3 |
| InChIKey | QSALYCYJVLKAFU-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|