C14H11ClN4 — CID 107051661
2-chloro-6-(3-phenyl-1H-1,2,4-triazol-5-yl)aniline (PubChem CID 107051661) has the molecular formula C14H11ClN4 and a molecular weight of 270.72 g/mol. Its IUPAC name is 2-chloro-6-(3-phenyl-1H-1,2,4-triazol-5-yl)aniline.
| Compound Name | 2-chloro-6-(3-phenyl-1H-1,2,4-triazol-5-yl)aniline |
|---|---|
| PubChem CID | 107051661 |
| Molecular Formula | C14H11ClN4 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 2-chloro-6-(3-phenyl-1H-1,2,4-triazol-5-yl)aniline |
| SMILES | Nc1c(Cl)cccc1-c1nc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C14H11ClN4/c15-11-8-4-7-10(12(11)16)14-17-13(18-19-14)9-5-2-1-3-6-9/h1-8H,16H2,(H,17,18,19) |
| InChIKey | KLQSBHAKVBKOFQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|