C20H13N3S — CID 118508901
5-dibenzothiophen-4-yl-3-phenyl-1H-1,2,4-triazole (PubChem CID 118508901) has the molecular formula C20H13N3S and a molecular weight of 327.41 g/mol. Its IUPAC name is 5-dibenzothiophen-4-yl-3-phenyl-1H-1,2,4-triazole.
| Compound Name | 5-dibenzothiophen-4-yl-3-phenyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 118508901 |
| Molecular Formula | C20H13N3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 5-dibenzothiophen-4-yl-3-phenyl-1H-1,2,4-triazole |
| SMILES | c1ccc(-c2n[nH]c(-c3cccc4c3sc3ccccc34)n2)cc1 |
| InChI | InChI=1S/C20H13N3S/c1-2-7-13(8-3-1)19-21-20(23-22-19)16-11-6-10-15-14-9-4-5-12-17(14)24-18(15)16/h1-12H,(H,21,22,23) |
| InChIKey | GUYAKZXMDDZEPL-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |