C17H18N4 — CID 174693862
[2-ethyl-6-(3-phenyl-1H-1,2,4-triazol-5-yl)phenyl]methanamine (PubChem CID 174693862) has the molecular formula C17H18N4 and a molecular weight of 278.36 g/mol. Its IUPAC name is [2-ethyl-6-(3-phenyl-1H-1,2,4-triazol-5-yl)phenyl]methanamine.
| Compound Name | [2-ethyl-6-(3-phenyl-1H-1,2,4-triazol-5-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 174693862 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | [2-ethyl-6-(3-phenyl-1H-1,2,4-triazol-5-yl)phenyl]methanamine |
| SMILES | CCc1cccc(-c2nc(-c3ccccc3)n[nH]2)c1CN |
| InChI | InChI=1S/C17H18N4/c1-2-12-9-6-10-14(15(12)11-18)17-19-16(20-21-17)13-7-4-3-5-8-13/h3-10H,2,11,18H2,1H3,(H,19,20,21) |
| InChIKey | PLLBQJHKZYDECL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |