C11H19N7 — CID 107053699
2-methyl-N-[[1-[(2-methyltetrazol-5-yl)methyl]pyrazol-4-yl]methyl]propan-1-amine (PubChem CID 107053699) has the molecular formula C11H19N7 and a molecular weight of 249.32 g/mol. Its IUPAC name is 2-methyl-N-[[1-[(2-methyltetrazol-5-yl)methyl]pyrazol-4-yl]methyl]propan-1-amine.
| Compound Name | 2-methyl-N-[[1-[(2-methyltetrazol-5-yl)methyl]pyrazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 107053699 |
| Molecular Formula | C11H19N7 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-methyl-N-[[1-[(2-methyltetrazol-5-yl)methyl]pyrazol-4-yl]methyl]propan-1-amine |
| SMILES | CC(C)CNCc1cnn(Cc2nnn(C)n2)c1 |
| InChI | InChI=1S/C11H19N7/c1-9(2)4-12-5-10-6-13-18(7-10)8-11-14-16-17(3)15-11/h6-7,9,12H,4-5,8H2,1-3H3 |
| InChIKey | AALUKIQBTMTSCF-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |