C12H21N7 — CID 107054670
2-methyl-N-[[3-methyl-1-[(2-methyltetrazol-5-yl)methyl]pyrazol-4-yl]methyl]propan-1-amine (PubChem CID 107054670) has the molecular formula C12H21N7 and a molecular weight of 263.35 g/mol. Its IUPAC name is 2-methyl-N-[[3-methyl-1-[(2-methyltetrazol-5-yl)methyl]pyrazol-4-yl]methyl]propan-1-amine.
| Compound Name | 2-methyl-N-[[3-methyl-1-[(2-methyltetrazol-5-yl)methyl]pyrazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 107054670 |
| Molecular Formula | C12H21N7 |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 2-methyl-N-[[3-methyl-1-[(2-methyltetrazol-5-yl)methyl]pyrazol-4-yl]methyl]propan-1-amine |
| SMILES | Cc1nn(Cc2nnn(C)n2)cc1CNCC(C)C |
| InChI | InChI=1S/C12H21N7/c1-9(2)5-13-6-11-7-19(15-10(11)3)8-12-14-17-18(4)16-12/h7,9,13H,5-6,8H2,1-4H3 |
| InChIKey | NYUFDOXYPCHXGJ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |