C11H20ClN5 — CID 107054049
1-(chloromethyl)-3-methyl-N-[(2-methyltetrazol-5-yl)methyl]cyclohexan-1-amine (PubChem CID 107054049) has the molecular formula C11H20ClN5 and a molecular weight of 257.77 g/mol. Its IUPAC name is 1-(chloromethyl)-3-methyl-N-[(2-methyltetrazol-5-yl)methyl]cyclohexan-1-amine.
| Compound Name | 1-(chloromethyl)-3-methyl-N-[(2-methyltetrazol-5-yl)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 107054049 |
| Molecular Formula | C11H20ClN5 |
| Molecular Weight | 257.77 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 1-(chloromethyl)-3-methyl-N-[(2-methyltetrazol-5-yl)methyl]cyclohexan-1-amine |
| SMILES | CC1CCCC(CCl)(NCc2nnn(C)n2)C1 |
| InChI | InChI=1S/C11H20ClN5/c1-9-4-3-5-11(6-9,8-12)13-7-10-14-16-17(2)15-10/h9,13H,3-8H2,1-2H3 |
| InChIKey | QSWKEPITNBCJKM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.77 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|