C7H10ClN3 — CID 107055424
4-(aminomethyl)-3-chloro-N-methylpyridin-2-amine (PubChem CID 107055424) has the molecular formula C7H10ClN3 and a molecular weight of 171.63 g/mol. Its IUPAC name is 4-(aminomethyl)-3-chloro-N-methylpyridin-2-amine.
| Compound Name | 4-(aminomethyl)-3-chloro-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 107055424 |
| Molecular Formula | C7H10ClN3 |
| Molecular Weight | 171.63 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 4-(aminomethyl)-3-chloro-N-methylpyridin-2-amine |
| SMILES | CNc1nccc(CN)c1Cl |
| InChI | InChI=1S/C7H10ClN3/c1-10-7-6(8)5(4-9)2-3-11-7/h2-3H,4,9H2,1H3,(H,10,11) |
| InChIKey | OHXVXSJECRGQCD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.63 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |