C6H10N4 — CID 15937929
3-(aminomethyl)-N-methylpyrazin-2-amine (PubChem CID 15937929) has the molecular formula C6H10N4 and a molecular weight of 138.17 g/mol. Its IUPAC name is 3-(aminomethyl)-N-methylpyrazin-2-amine.
| Compound Name | 3-(aminomethyl)-N-methylpyrazin-2-amine |
|---|---|
| PubChem CID | 15937929 |
| Molecular Formula | C6H10N4 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | 3-(aminomethyl)-N-methylpyrazin-2-amine |
| SMILES | CNc1nccnc1CN |
| InChI | InChI=1S/C6H10N4/c1-8-6-5(4-7)9-2-3-10-6/h2-3H,4,7H2,1H3,(H,8,10) |
| InChIKey | AUZJCLPBJLECSL-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |