C6H10N4 — CID 130593934
2-N-methylpyridine-2,3,4-triamine (PubChem CID 130593934) has the molecular formula C6H10N4 and a molecular weight of 138.17 g/mol. Its IUPAC name is 2-N-methylpyridine-2,3,4-triamine.
| Compound Name | 2-N-methylpyridine-2,3,4-triamine |
|---|---|
| PubChem CID | 130593934 |
| Molecular Formula | C6H10N4 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | 2-N-methylpyridine-2,3,4-triamine |
| SMILES | CNc1nccc(N)c1N |
| InChI | InChI=1S/C6H10N4/c1-9-6-5(8)4(7)2-3-10-6/h2-3H,8H2,1H3,(H3,7,9,10) |
| InChIKey | QTLAGZALZZLBON-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |