C9H14N4 — CID 131241598
2-N-[(E)-but-2-enyl]pyridine-2,3,4-triamine (PubChem CID 131241598) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is 2-N-[(E)-but-2-enyl]pyridine-2,3,4-triamine.
| Compound Name | 2-N-[(E)-but-2-enyl]pyridine-2,3,4-triamine |
|---|---|
| PubChem CID | 131241598 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 2-N-[(E)-but-2-enyl]pyridine-2,3,4-triamine |
| SMILES | C/C=C/CNc1nccc(N)c1N |
| InChI | InChI=1S/C9H14N4/c1-2-3-5-12-9-8(11)7(10)4-6-13-9/h2-4,6H,5,11H2,1H3,(H3,10,12,13)/b3-2+ |
| InChIKey | MYGXAQXYWYQSPY-NSCUHMNNSA-N |
| XLogP | 1.23 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|