C10H18N4 — CID 130593940
2-N-(3-methylbutyl)pyridine-2,3,4-triamine (PubChem CID 130593940) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-N-(3-methylbutyl)pyridine-2,3,4-triamine.
| Compound Name | 2-N-(3-methylbutyl)pyridine-2,3,4-triamine |
|---|---|
| PubChem CID | 130593940 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 2-N-(3-methylbutyl)pyridine-2,3,4-triamine |
| SMILES | CC(C)CCNc1nccc(N)c1N |
| InChI | InChI=1S/C10H18N4/c1-7(2)3-5-13-10-9(12)8(11)4-6-14-10/h4,6-7H,3,5,12H2,1-2H3,(H3,11,13,14) |
| InChIKey | ONOPTJAAJWLBCC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |