C9H13N3 — CID 131240121
6-N-[(E)-but-2-enyl]pyridine-2,6-diamine (PubChem CID 131240121) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 6-N-[(E)-but-2-enyl]pyridine-2,6-diamine.
| Compound Name | 6-N-[(E)-but-2-enyl]pyridine-2,6-diamine |
|---|---|
| PubChem CID | 131240121 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 6-N-[(E)-but-2-enyl]pyridine-2,6-diamine |
| SMILES | C/C=C/CNc1cccc(N)n1 |
| InChI | InChI=1S/C9H13N3/c1-2-3-7-11-9-6-4-5-8(10)12-9/h2-6H,7H2,1H3,(H3,10,11,12)/b3-2+ |
| InChIKey | AZBZQHWCXZHFOO-NSCUHMNNSA-N |
| XLogP | 1.65 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|