C12H9ClN6S — CID 107060954
3-chloro-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pyridine-4-carboximidamide (PubChem CID 107060954) has the molecular formula C12H9ClN6S and a molecular weight of 304.77 g/mol. Its IUPAC name is 3-chloro-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pyridine-4-carboximidamide.
| Compound Name | 3-chloro-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 107060954 |
| Molecular Formula | C12H9ClN6S |
| Molecular Weight | 304.77 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 3-chloro-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pyridine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccnc(Sc2nnc3ccccn23)c1Cl |
| InChI | InChI=1S/C12H9ClN6S/c13-9-7(10(14)15)4-5-16-11(9)20-12-18-17-8-3-1-2-6-19(8)12/h1-6H,(H3,14,15) |
| InChIKey | DMDGVRQCTABODI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.77 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|