C13H18O5 — CID 10706100
[(E)-3-[(2S,3S,5S)-3-acetyloxy-5-ethenyloxolan-2-yl]prop-2-enyl] acetate (PubChem CID 10706100) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is [(E)-3-[(2S,3S,5S)-3-acetyloxy-5-ethenyloxolan-2-yl]prop-2-enyl] acetate.
| Compound Name | [(E)-3-[(2S,3S,5S)-3-acetyloxy-5-ethenyloxolan-2-yl]prop-2-enyl] acetate |
|---|---|
| PubChem CID | 10706100 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | [(E)-3-[(2S,3S,5S)-3-acetyloxy-5-ethenyloxolan-2-yl]prop-2-enyl] acetate |
| SMILES | C=C[C@@H]1C[C@H](OC(C)=O)[C@H](/C=C/COC(C)=O)O1 |
| InChI | InChI=1S/C13H18O5/c1-4-11-8-13(17-10(3)15)12(18-11)6-5-7-16-9(2)14/h4-6,11-13H,1,7-8H2,2-3H3/b6-5+/t11-,12+,13+/m1/s1 |
| InChIKey | CFWSZSHQUNLXFM-NIRPKFQOSA-N |
| XLogP | 1.38 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|